C13H20N4O4S — CID 108529150
N-(2,2-dimethoxyethyl)-N'-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)oxamide (PubChem CID 108529150) has the molecular formula C13H20N4O4S and a molecular weight of 328.39 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N'-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)oxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N'-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)oxamide |
|---|---|
| PubChem CID | 108529150 |
| Molecular Formula | C13H20N4O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N'-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)oxamide |
| SMILES | COC(CNC(=O)C(=O)Nc1nc2c(s1)CN(C)CC2)OC |
| InChI | InChI=1S/C13H20N4O4S/c1-17-5-4-8-9(7-17)22-13(15-8)16-12(19)11(18)14-6-10(20-2)21-3/h10H,4-7H2,1-3H3,(H,14,18)(H,15,16,19) |
| InChIKey | ZKGOAEGPYGZFKF-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|