C17H31N3O2 — CID 108522373
1-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-(3-methylpiperidin-1-yl)ethane-1,2-dione (PubChem CID 108522373) has the molecular formula C17H31N3O2 and a molecular weight of 309.45 g/mol. Its IUPAC name is 1-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-(3-methylpiperidin-1-yl)ethane-1,2-dione.
| Compound Name | 1-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-(3-methylpiperidin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 108522373 |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | 1-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-(3-methylpiperidin-1-yl)ethane-1,2-dione |
| SMILES | CC1CCCN(C(=O)C(=O)N2C(C)(C)CC(N)CC2(C)C)C1 |
| InChI | InChI=1S/C17H31N3O2/c1-12-7-6-8-19(11-12)14(21)15(22)20-16(2,3)9-13(18)10-17(20,4)5/h12-13H,6-11,18H2,1-5H3 |
| InChIKey | RWBXIQAPCSDQEA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|