C14H18BrN3O3 — CID 108522875
N-(3-bromophenyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 108522875) has the molecular formula C14H18BrN3O3 and a molecular weight of 356.22 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-(3-bromophenyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108522875 |
| Molecular Formula | C14H18BrN3O3 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N-(3-bromophenyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | O=C(Nc1cccc(Br)c1)C(=O)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C14H18BrN3O3/c15-11-2-1-3-12(10-11)16-13(20)14(21)18-6-4-17(5-7-18)8-9-19/h1-3,10,19H,4-9H2,(H,16,20) |
| InChIKey | ZXPVRBDDTSVYKX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|