C18H22N4O2S — CID 108523244
N'-benzyl-N'-ethyl-N-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)oxamide (PubChem CID 108523244) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is N'-benzyl-N'-ethyl-N-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)oxamide.
| Compound Name | N'-benzyl-N'-ethyl-N-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)oxamide |
|---|---|
| PubChem CID | 108523244 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N'-benzyl-N'-ethyl-N-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)oxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C(=O)Nc1nc2c(s1)CN(C)CC2 |
| InChI | InChI=1S/C18H22N4O2S/c1-3-22(11-13-7-5-4-6-8-13)17(24)16(23)20-18-19-14-9-10-21(2)12-15(14)25-18/h4-8H,3,9-12H2,1-2H3,(H,19,20,23) |
| InChIKey | PBQGKDPISIZGKS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|