C17H24N4O4 — CID 108528811
N-(3-aminopropyl)-N-formyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 108528811) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-formyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-(3-aminopropyl)-N-formyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108528811 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-(3-aminopropyl)-N-formyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | COc1ccccc1N1CCN(C(=O)C(=O)N(C=O)CCCN)CC1 |
| InChI | InChI=1S/C17H24N4O4/c1-25-15-6-3-2-5-14(15)19-9-11-20(12-10-19)16(23)17(24)21(13-22)8-4-7-18/h2-3,5-6,13H,4,7-12,18H2,1H3 |
| InChIKey | GARQMUTZXZZMOV-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|