C17H17BrN2O3 — CID 108531639
N'-(2-bromo-4-methylphenyl)-N-[(2-methoxyphenyl)methyl]oxamide (PubChem CID 108531639) has the molecular formula C17H17BrN2O3 and a molecular weight of 377.24 g/mol. Its IUPAC name is N'-(2-bromo-4-methylphenyl)-N-[(2-methoxyphenyl)methyl]oxamide.
| Compound Name | N'-(2-bromo-4-methylphenyl)-N-[(2-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 108531639 |
| Molecular Formula | C17H17BrN2O3 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | N'-(2-bromo-4-methylphenyl)-N-[(2-methoxyphenyl)methyl]oxamide |
| SMILES | COc1ccccc1CNC(=O)C(=O)Nc1ccc(C)cc1Br |
| InChI | InChI=1S/C17H17BrN2O3/c1-11-7-8-14(13(18)9-11)20-17(22)16(21)19-10-12-5-3-4-6-15(12)23-2/h3-9H,10H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | BJSWDIFHHPWDJX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|