C22H26N4O5 — CID 4206125
3-[2-[2-(2-methoxy-5-methylanilino)-2-oxoacetyl]hydrazinyl]-N-[(2-methoxyphenyl)methyl]but-3-enamide (PubChem CID 4206125) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxy-5-methylanilino)-2-oxoacetyl]hydrazinyl]-N-[(2-methoxyphenyl)methyl]but-3-enamide.
| Compound Name | 3-[2-[2-(2-methoxy-5-methylanilino)-2-oxoacetyl]hydrazinyl]-N-[(2-methoxyphenyl)methyl]but-3-enamide |
|---|---|
| PubChem CID | 4206125 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 3-[2-[2-(2-methoxy-5-methylanilino)-2-oxoacetyl]hydrazinyl]-N-[(2-methoxyphenyl)methyl]but-3-enamide |
| SMILES | C=C(CC(=O)NCc1ccccc1OC)NNC(=O)C(=O)Nc1cc(C)ccc1OC |
| InChI | InChI=1S/C22H26N4O5/c1-14-9-10-19(31-4)17(11-14)24-21(28)22(29)26-25-15(2)12-20(27)23-13-16-7-5-6-8-18(16)30-3/h5-11,25H,2,12-13H2,1,3-4H3,(H,23,27)(H,24,28)(H,26,29) |
| InChIKey | UMCYZKFEGIZMRR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|