C17H23N5O3 — CID 108532151
N-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)acetyl]piperidine-4-carboxamide (PubChem CID 108532151) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)acetyl]piperidine-4-carboxamide.
| Compound Name | N-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 108532151 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)acetyl]piperidine-4-carboxamide |
| SMILES | O=C(NC(=O)C1CCNCC1)C(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C17H23N5O3/c23-15(13-4-7-18-8-5-13)20-16(24)17(25)22-11-9-21(10-12-22)14-3-1-2-6-19-14/h1-3,6,13,18H,4-5,7-12H2,(H,20,23,24) |
| InChIKey | XQWFZBMSPNUHAS-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|