C16H18ClF3N2O3 — CID 108532221
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[2-(2-hydroxyethyl)piperidin-1-yl]-2-oxoacetamide (PubChem CID 108532221) has the molecular formula C16H18ClF3N2O3 and a molecular weight of 378.78 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[2-(2-hydroxyethyl)piperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[2-(2-hydroxyethyl)piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108532221 |
| Molecular Formula | C16H18ClF3N2O3 |
| Molecular Weight | 378.78 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[2-(2-hydroxyethyl)piperidin-1-yl]-2-oxoacetamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(F)(F)F)C(=O)N1CCCCC1CCO |
| InChI | InChI=1S/C16H18ClF3N2O3/c17-10-4-5-13(12(9-10)16(18,19)20)21-14(24)15(25)22-7-2-1-3-11(22)6-8-23/h4-5,9,11,23H,1-3,6-8H2,(H,21,24) |
| InChIKey | SNQUOAHDFFMQNR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.78 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|