C16H24N2O2 — CID 108532502
N'-ethyl-N-(3-methylbutyl)-N'-(3-methylphenyl)oxamide (PubChem CID 108532502) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N'-ethyl-N-(3-methylbutyl)-N'-(3-methylphenyl)oxamide.
| Compound Name | N'-ethyl-N-(3-methylbutyl)-N'-(3-methylphenyl)oxamide |
|---|---|
| PubChem CID | 108532502 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N'-ethyl-N-(3-methylbutyl)-N'-(3-methylphenyl)oxamide |
| SMILES | CCN(C(=O)C(=O)NCCC(C)C)c1cccc(C)c1 |
| InChI | InChI=1S/C16H24N2O2/c1-5-18(14-8-6-7-13(4)11-14)16(20)15(19)17-10-9-12(2)3/h6-8,11-12H,5,9-10H2,1-4H3,(H,17,19) |
| InChIKey | REZUHZCHAPJFTL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|