C18H21N3O4S — CID 108520362
N'-ethyl-N'-(3-methylphenyl)-N-[(4-sulfamoylphenyl)methyl]oxamide (PubChem CID 108520362) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is N'-ethyl-N'-(3-methylphenyl)-N-[(4-sulfamoylphenyl)methyl]oxamide.
| Compound Name | N'-ethyl-N'-(3-methylphenyl)-N-[(4-sulfamoylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 108520362 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N'-ethyl-N'-(3-methylphenyl)-N-[(4-sulfamoylphenyl)methyl]oxamide |
| SMILES | CCN(C(=O)C(=O)NCc1ccc(S(N)(=O)=O)cc1)c1cccc(C)c1 |
| InChI | InChI=1S/C18H21N3O4S/c1-3-21(15-6-4-5-13(2)11-15)18(23)17(22)20-12-14-7-9-16(10-8-14)26(19,24)25/h4-11H,3,12H2,1-2H3,(H,20,22)(H2,19,24,25) |
| InChIKey | BJXJKOVUDTUDHP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|