C8H8F5I — CID 10853536
1-iodo-2-(1,1,2,3,3-pentafluoroprop-2-enyl)cyclopentane (PubChem CID 10853536) has the molecular formula C8H8F5I and a molecular weight of 326.05 g/mol. Its IUPAC name is 1-iodo-2-(1,1,2,3,3-pentafluoroprop-2-enyl)cyclopentane.
| Compound Name | 1-iodo-2-(1,1,2,3,3-pentafluoroprop-2-enyl)cyclopentane |
|---|---|
| PubChem CID | 10853536 |
| Molecular Formula | C8H8F5I |
| Molecular Weight | 326.05 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | 1-iodo-2-(1,1,2,3,3-pentafluoroprop-2-enyl)cyclopentane |
| SMILES | FC(F)=C(F)C(F)(F)C1CCCC1I |
| InChI | InChI=1S/C8H8F5I/c9-6(7(10)11)8(12,13)4-2-1-3-5(4)14/h4-5H,1-3H2 |
| InChIKey | IJOBHEDEZOOIQR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.05 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|