C22H26N2O5 — CID 108535906
1-[4-(3,5-dihydroxybenzoyl)piperazin-1-yl]-2-(4-propylphenoxy)ethanone (PubChem CID 108535906) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 1-[4-(3,5-dihydroxybenzoyl)piperazin-1-yl]-2-(4-propylphenoxy)ethanone.
| Compound Name | 1-[4-(3,5-dihydroxybenzoyl)piperazin-1-yl]-2-(4-propylphenoxy)ethanone |
|---|---|
| PubChem CID | 108535906 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-[4-(3,5-dihydroxybenzoyl)piperazin-1-yl]-2-(4-propylphenoxy)ethanone |
| SMILES | CCCc1ccc(OCC(=O)N2CCN(C(=O)c3cc(O)cc(O)c3)CC2)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-2-3-16-4-6-20(7-5-16)29-15-21(27)23-8-10-24(11-9-23)22(28)17-12-18(25)14-19(26)13-17/h4-7,12-14,25-26H,2-3,8-11,15H2,1H3 |
| InChIKey | LWGPYOHRLAPMTD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |