C18H25ClN2O5 — CID 108535954
2-(4-chlorophenoxy)-1-[4-[2-(2-methoxyethoxy)acetyl]piperazin-1-yl]propan-1-one (PubChem CID 108535954) has the molecular formula C18H25ClN2O5 and a molecular weight of 384.86 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1-[4-[2-(2-methoxyethoxy)acetyl]piperazin-1-yl]propan-1-one.
| Compound Name | 2-(4-chlorophenoxy)-1-[4-[2-(2-methoxyethoxy)acetyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 108535954 |
| Molecular Formula | C18H25ClN2O5 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-(4-chlorophenoxy)-1-[4-[2-(2-methoxyethoxy)acetyl]piperazin-1-yl]propan-1-one |
| SMILES | COCCOCC(=O)N1CCN(C(=O)C(C)Oc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H25ClN2O5/c1-14(26-16-5-3-15(19)4-6-16)18(23)21-9-7-20(8-10-21)17(22)13-25-12-11-24-2/h3-6,14H,7-13H2,1-2H3 |
| InChIKey | RTFBWVUAOHXSLA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|