C22H23ClN2O3 — CID 108568868
2-(4-chlorophenoxy)-1-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]propan-1-one (PubChem CID 108568868) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]propan-1-one.
| Compound Name | 2-(4-chlorophenoxy)-1-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 108568868 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-(4-chlorophenoxy)-1-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]propan-1-one |
| SMILES | CC(Oc1ccc(Cl)cc1)C(=O)N1CCN(C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C22H23ClN2O3/c1-17(28-20-10-8-19(23)9-11-20)22(27)25-15-13-24(14-16-25)21(26)12-7-18-5-3-2-4-6-18/h2-12,17H,13-16H2,1H3/b12-7+ |
| InChIKey | RKPOERGRSIJGMK-KPKJPENVSA-N |
| XLogP | 3.49 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|