C16H29N3O4 — CID 10853670
tert-butyl (NZ)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-piperidin-1-ylmethylidene]carbamate (PubChem CID 10853670) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-piperidin-1-ylmethylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-piperidin-1-ylmethylidene]carbamate |
|---|---|
| PubChem CID | 10853670 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | tert-butyl (NZ)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-piperidin-1-ylmethylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=C(/NC(=O)OC(C)(C)C)N1CCCCC1 |
| InChI | InChI=1S/C16H29N3O4/c1-15(2,3)22-13(20)17-12(19-10-8-7-9-11-19)18-14(21)23-16(4,5)6/h7-11H2,1-6H3,(H,17,18,20,21) |
| InChIKey | AEJACKHZEFAIIH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|