C25H46N4O6 — CID 59140968
tert-butyl N-[(Z)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[3-(1-methylpiperidin-4-yl)propyl]carbamate (PubChem CID 59140968) has the molecular formula C25H46N4O6 and a molecular weight of 498.67 g/mol. Its IUPAC name is tert-butyl N-[(Z)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[3-(1-methylpiperidin-4-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[3-(1-methylpiperidin-4-yl)propyl]carbamate |
|---|---|
| PubChem CID | 59140968 |
| Molecular Formula | C25H46N4O6 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.34 |
| IUPAC Name | tert-butyl N-[(Z)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[3-(1-methylpiperidin-4-yl)propyl]carbamate |
| SMILES | CN1CCC(CCCN(C(=O)OC(C)(C)C)/C(=N\C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C25H46N4O6/c1-23(2,3)33-20(30)26-19(27-21(31)34-24(4,5)6)29(22(32)35-25(7,8)9)15-11-12-18-13-16-28(10)17-14-18/h18H,11-17H2,1-10H3,(H,26,27,30,31) |
| InChIKey | HCLKADIFHVYKOQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|