C19H24O3S — CID 10854047
ethyl (E,2E)-2-[5-(phenylsulfanylmethyl)oxolan-2-ylidene]hex-4-enoate (PubChem CID 10854047) has the molecular formula C19H24O3S and a molecular weight of 332.47 g/mol. Its IUPAC name is ethyl (E,2E)-2-[5-(phenylsulfanylmethyl)oxolan-2-ylidene]hex-4-enoate.
| Compound Name | ethyl (E,2E)-2-[5-(phenylsulfanylmethyl)oxolan-2-ylidene]hex-4-enoate |
|---|---|
| PubChem CID | 10854047 |
| Molecular Formula | C19H24O3S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | ethyl (E,2E)-2-[5-(phenylsulfanylmethyl)oxolan-2-ylidene]hex-4-enoate |
| SMILES | C/C=C/C/C(C(=O)OCC)=C1/CCC(CSc2ccccc2)O1 |
| InChI | InChI=1S/C19H24O3S/c1-3-5-11-17(19(20)21-4-2)18-13-12-15(22-18)14-23-16-9-7-6-8-10-16/h3,5-10,15H,4,11-14H2,1-2H3/b5-3+,18-17+ |
| InChIKey | CEIHGGQLCXDUEA-UTCKLEJXSA-N |
| XLogP | 4.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|