C17H19N3O3S — CID 108541843
3-acetamido-N-[2-[(2-thiophen-2-ylacetyl)amino]ethyl]benzamide (PubChem CID 108541843) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 3-acetamido-N-[2-[(2-thiophen-2-ylacetyl)amino]ethyl]benzamide.
| Compound Name | 3-acetamido-N-[2-[(2-thiophen-2-ylacetyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108541843 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-acetamido-N-[2-[(2-thiophen-2-ylacetyl)amino]ethyl]benzamide |
| SMILES | CC(=O)Nc1cccc(C(=O)NCCNC(=O)Cc2cccs2)c1 |
| InChI | InChI=1S/C17H19N3O3S/c1-12(21)20-14-5-2-4-13(10-14)17(23)19-8-7-18-16(22)11-15-6-3-9-24-15/h2-6,9-10H,7-8,11H2,1H3,(H,18,22)(H,19,23)(H,20,21) |
| InChIKey | WNLWRBVBJODJNS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|