C17H21N3O4S2 — CID 113071084
N-[2-(3-acetamido-N-methylsulfonylanilino)ethyl]-2-thiophen-2-ylacetamide (PubChem CID 113071084) has the molecular formula C17H21N3O4S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N-[2-(3-acetamido-N-methylsulfonylanilino)ethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-(3-acetamido-N-methylsulfonylanilino)ethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113071084 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | N-[2-(3-acetamido-N-methylsulfonylanilino)ethyl]-2-thiophen-2-ylacetamide |
| SMILES | CC(=O)Nc1cccc(N(CCNC(=O)Cc2cccs2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H21N3O4S2/c1-13(21)19-14-5-3-6-15(11-14)20(26(2,23)24)9-8-18-17(22)12-16-7-4-10-25-16/h3-7,10-11H,8-9,12H2,1-2H3,(H,18,22)(H,19,21) |
| InChIKey | MNPJSUXTUGDOTF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |