C15H23N3O4S — CID 113071066
N-[2-(3-acetamido-N-methylsulfonylanilino)ethyl]butanamide (PubChem CID 113071066) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is N-[2-(3-acetamido-N-methylsulfonylanilino)ethyl]butanamide.
| Compound Name | N-[2-(3-acetamido-N-methylsulfonylanilino)ethyl]butanamide |
|---|---|
| PubChem CID | 113071066 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-[2-(3-acetamido-N-methylsulfonylanilino)ethyl]butanamide |
| SMILES | CCCC(=O)NCCN(c1cccc(NC(C)=O)c1)S(C)(=O)=O |
| InChI | InChI=1S/C15H23N3O4S/c1-4-6-15(20)16-9-10-18(23(3,21)22)14-8-5-7-13(11-14)17-12(2)19/h5,7-8,11H,4,6,9-10H2,1-3H3,(H,16,20)(H,17,19) |
| InChIKey | XJKOSSARYSNZLV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |