C16H20N2O3S2 — CID 113068548
N-[2-(2-methyl-N-methylsulfonylanilino)ethyl]-2-thiophen-2-ylacetamide (PubChem CID 113068548) has the molecular formula C16H20N2O3S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[2-(2-methyl-N-methylsulfonylanilino)ethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-(2-methyl-N-methylsulfonylanilino)ethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113068548 |
| Molecular Formula | C16H20N2O3S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-[2-(2-methyl-N-methylsulfonylanilino)ethyl]-2-thiophen-2-ylacetamide |
| SMILES | Cc1ccccc1N(CCNC(=O)Cc1cccs1)S(C)(=O)=O |
| InChI | InChI=1S/C16H20N2O3S2/c1-13-6-3-4-8-15(13)18(23(2,20)21)10-9-17-16(19)12-14-7-5-11-22-14/h3-8,11H,9-10,12H2,1-2H3,(H,17,19) |
| InChIKey | XBYXTPXYRVKYQP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |