C14H14BrF3N2O2 — CID 108543649
1-[4-(4-bromobenzoyl)-1,4-diazepan-1-yl]-2,2,2-trifluoroethanone (PubChem CID 108543649) has the molecular formula C14H14BrF3N2O2 and a molecular weight of 379.18 g/mol. Its IUPAC name is 1-[4-(4-bromobenzoyl)-1,4-diazepan-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[4-(4-bromobenzoyl)-1,4-diazepan-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 108543649 |
| Molecular Formula | C14H14BrF3N2O2 |
| Molecular Weight | 379.18 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 1-[4-(4-bromobenzoyl)-1,4-diazepan-1-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1ccc(Br)cc1)N1CCCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H14BrF3N2O2/c15-11-4-2-10(3-5-11)12(21)19-6-1-7-20(9-8-19)13(22)14(16,17)18/h2-5H,1,6-9H2 |
| InChIKey | ZCRSIPQJMVNLHS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |