C22H30N4O3 — CID 108545366
3-[4-[2-(1-adamantyl)acetyl]-1,4-diazepane-1-carbonyl]-1H-pyridazin-6-one (PubChem CID 108545366) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is 3-[4-[2-(1-adamantyl)acetyl]-1,4-diazepane-1-carbonyl]-1H-pyridazin-6-one.
| Compound Name | 3-[4-[2-(1-adamantyl)acetyl]-1,4-diazepane-1-carbonyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 108545366 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 3-[4-[2-(1-adamantyl)acetyl]-1,4-diazepane-1-carbonyl]-1H-pyridazin-6-one |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)N1CCCN(C(=O)c2ccc(=O)[nH]n2)CC1 |
| InChI | InChI=1S/C22H30N4O3/c27-19-3-2-18(23-24-19)21(29)26-5-1-4-25(6-7-26)20(28)14-22-11-15-8-16(12-22)10-17(9-15)13-22/h2-3,15-17H,1,4-14H2,(H,24,27) |
| InChIKey | HECJUSYECRTYPA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |