C21H32N2O3 — CID 108555635
2-ethyl-N-[1-[2-(2-ethylphenoxy)acetyl]piperidin-4-yl]butanamide (PubChem CID 108555635) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 2-ethyl-N-[1-[2-(2-ethylphenoxy)acetyl]piperidin-4-yl]butanamide.
| Compound Name | 2-ethyl-N-[1-[2-(2-ethylphenoxy)acetyl]piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 108555635 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 2-ethyl-N-[1-[2-(2-ethylphenoxy)acetyl]piperidin-4-yl]butanamide |
| SMILES | CCc1ccccc1OCC(=O)N1CCC(NC(=O)C(CC)CC)CC1 |
| InChI | InChI=1S/C21H32N2O3/c1-4-16(5-2)21(25)22-18-11-13-23(14-12-18)20(24)15-26-19-10-8-7-9-17(19)6-3/h7-10,16,18H,4-6,11-15H2,1-3H3,(H,22,25) |
| InChIKey | PTXVANRCXIVBRK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |