C19H28N2O4 — CID 108556239
N-[1-[2-(2-ethylphenoxy)acetyl]piperidin-4-yl]-3-methoxypropanamide (PubChem CID 108556239) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is N-[1-[2-(2-ethylphenoxy)acetyl]piperidin-4-yl]-3-methoxypropanamide.
| Compound Name | N-[1-[2-(2-ethylphenoxy)acetyl]piperidin-4-yl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 108556239 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-[1-[2-(2-ethylphenoxy)acetyl]piperidin-4-yl]-3-methoxypropanamide |
| SMILES | CCc1ccccc1OCC(=O)N1CCC(NC(=O)CCOC)CC1 |
| InChI | InChI=1S/C19H28N2O4/c1-3-15-6-4-5-7-17(15)25-14-19(23)21-11-8-16(9-12-21)20-18(22)10-13-24-2/h4-7,16H,3,8-14H2,1-2H3,(H,20,22) |
| InChIKey | TZNDVOOHNIVXCF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |