C18H17F3N2O2S — CID 108556797
2,3,4-trifluoro-N-[1-(2-thiophen-2-ylacetyl)piperidin-4-yl]benzamide (PubChem CID 108556797) has the molecular formula C18H17F3N2O2S and a molecular weight of 382.41 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[1-(2-thiophen-2-ylacetyl)piperidin-4-yl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[1-(2-thiophen-2-ylacetyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108556797 |
| Molecular Formula | C18H17F3N2O2S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2,3,4-trifluoro-N-[1-(2-thiophen-2-ylacetyl)piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(C(=O)Cc2cccs2)CC1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H17F3N2O2S/c19-14-4-3-13(16(20)17(14)21)18(25)22-11-5-7-23(8-6-11)15(24)10-12-2-1-9-26-12/h1-4,9,11H,5-8,10H2,(H,22,25) |
| InChIKey | SLDJOPCTEBUSHQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|