C17H20N2O2S2 — CID 49361441
5-methyl-N-[1-(2-thiophen-2-ylacetyl)piperidin-4-yl]thiophene-2-carboxamide (PubChem CID 49361441) has the molecular formula C17H20N2O2S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 5-methyl-N-[1-(2-thiophen-2-ylacetyl)piperidin-4-yl]thiophene-2-carboxamide.
| Compound Name | 5-methyl-N-[1-(2-thiophen-2-ylacetyl)piperidin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 49361441 |
| Molecular Formula | C17H20N2O2S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 5-methyl-N-[1-(2-thiophen-2-ylacetyl)piperidin-4-yl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NC2CCN(C(=O)Cc3cccs3)CC2)s1 |
| InChI | InChI=1S/C17H20N2O2S2/c1-12-4-5-15(23-12)17(21)18-13-6-8-19(9-7-13)16(20)11-14-3-2-10-22-14/h2-5,10,13H,6-9,11H2,1H3,(H,18,21) |
| InChIKey | UTJXWNVAPLEEBY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |