C10H12O2 — CID 10855823
8-methyl-1-oxaspiro[4.5]deca-3,7-dien-2-one (PubChem CID 10855823) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 8-methyl-1-oxaspiro[4.5]deca-3,7-dien-2-one.
| Compound Name | 8-methyl-1-oxaspiro[4.5]deca-3,7-dien-2-one |
|---|---|
| PubChem CID | 10855823 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 8-methyl-1-oxaspiro[4.5]deca-3,7-dien-2-one |
| SMILES | CC1=CCC2(C=CC(=O)O2)CC1 |
| InChI | InChI=1S/C10H12O2/c1-8-2-5-10(6-3-8)7-4-9(11)12-10/h2,4,7H,3,5-6H2,1H3 |
| InChIKey | VDNKBGBKFBTIEM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|