C10H14O2 — CID 10855853
1-[(2S)-3,6-dihydro-2H-pyran-2-yl]pent-4-en-1-one (PubChem CID 10855853) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-[(2S)-3,6-dihydro-2H-pyran-2-yl]pent-4-en-1-one.
| Compound Name | 1-[(2S)-3,6-dihydro-2H-pyran-2-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 10855853 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 1-[(2S)-3,6-dihydro-2H-pyran-2-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)[C@@H]1CC=CCO1 |
| InChI | InChI=1S/C10H14O2/c1-2-3-6-9(11)10-7-4-5-8-12-10/h2,4-5,10H,1,3,6-8H2/t10-/m0/s1 |
| InChIKey | XLAQNKMJNYTLNR-JTQLQIEISA-N |
| XLogP | 1.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|