C7H10O2 — CID 20692457
1-(3,6-dihydro-2H-pyran-2-yl)ethanone (PubChem CID 20692457) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is 1-(3,6-dihydro-2H-pyran-2-yl)ethanone.
| Compound Name | 1-(3,6-dihydro-2H-pyran-2-yl)ethanone |
|---|---|
| PubChem CID | 20692457 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 1-(3,6-dihydro-2H-pyran-2-yl)ethanone |
| SMILES | CC(=O)C1CC=CCO1 |
| InChI | InChI=1S/C7H10O2/c1-6(8)7-4-2-3-5-9-7/h2-3,7H,4-5H2,1H3 |
| InChIKey | CESUCHBNFYSUMX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|