About N'-(2-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide
N'-(2-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide (PubChem CID 10855859) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is N'-(2-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide.
Molecular Properties
| Compound Name | N'-(2-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide |
| PubChem CID | 10855859 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | N'-(2-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide |
| SMILES | CCn1nccc1/N=C/N(C)C |
| InChI | InChI=1S/C8H14N4/c1-4-12-8(5-6-10-12)9-7-11(2)3/h5-7H,4H2,1-3H3/b9-7+ |
| InChIKey | ILBHEGKWJUHKMG-VQHVLOKHSA-N |
| XLogP | 1.12 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide?
The IUPAC name of N'-(2-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide (CID 10855859) is N'-(2-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide.
What is the SMILES notation for N'-(2-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide?
The canonical SMILES for N'-(2-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide is CCn1nccc1/N=C/N(C)C.
What is the InChIKey of N'-(2-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide?
The InChIKey is ILBHEGKWJUHKMG-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H14N4/c1-4-12-8(5-6-10-12)9-7-11(2)3/h5-7H,4H2,1-3H3/b9-7+.
What are the key properties of N'-(2-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide?
N'-(2-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide has a molecular weight of 166.23 g/mol, XLogP of 1.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide is sourced from PubChem (CID 10855859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).