C17H29N3O5 — CID 108558940
prop-2-enyl 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]piperidine-1-carboxylate (PubChem CID 108558940) has the molecular formula C17H29N3O5 and a molecular weight of 355.44 g/mol. Its IUPAC name is prop-2-enyl 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]piperidine-1-carboxylate.
| Compound Name | prop-2-enyl 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108558940 |
| Molecular Formula | C17H29N3O5 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | prop-2-enyl 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]piperidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCC(NC(=O)CCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H29N3O5/c1-5-12-24-16(23)20-10-7-13(8-11-20)19-14(21)6-9-18-15(22)25-17(2,3)4/h5,13H,1,6-12H2,2-4H3,(H,18,22)(H,19,21) |
| InChIKey | ZRKVFXFVYATBBI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|