C16H28N2O5 — CID 76687453
ethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypiperidine-1-carboxylate (PubChem CID 76687453) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is ethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypiperidine-1-carboxylate.
| Compound Name | ethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 76687453 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | ethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypiperidine-1-carboxylate |
| SMILES | C=CCOC1CN(C(=O)OCC)CCC1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N2O5/c1-6-10-22-13-11-18(15(20)21-7-2)9-8-12(13)17-14(19)23-16(3,4)5/h6,12-13H,1,7-11H2,2-5H3,(H,17,19) |
| InChIKey | SWJROQCKMJUQMI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|