C16H28N2O5 — CID 66707713
(3S,4R)-2-ethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypiperidine-1-carboxylic acid (PubChem CID 66707713) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is (3S,4R)-2-ethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypiperidine-1-carboxylic acid.
| Compound Name | (3S,4R)-2-ethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66707713 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (3S,4R)-2-ethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypiperidine-1-carboxylic acid |
| SMILES | C=CCO[C@@H]1C(CC)N(C(=O)O)CC[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N2O5/c1-6-10-22-13-11(17-14(19)23-16(3,4)5)8-9-18(15(20)21)12(13)7-2/h6,11-13H,1,7-10H2,2-5H3,(H,17,19)(H,20,21)/t11-,12?,13+/m1/s1 |
| InChIKey | MCVYKBDRVJMCOH-YPHAAILGSA-N |
| XLogP | 2.61 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|