C13H22N2O5 — CID 67286151
(3S,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-prop-2-enoxypyrrolidine-1-carboxylic acid (PubChem CID 67286151) has the molecular formula C13H22N2O5 and a molecular weight of 286.33 g/mol. Its IUPAC name is (3S,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-prop-2-enoxypyrrolidine-1-carboxylic acid.
| Compound Name | (3S,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-prop-2-enoxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67286151 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | (3S,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-prop-2-enoxypyrrolidine-1-carboxylic acid |
| SMILES | C=CCO[C@H]1CN(C(=O)O)C[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22N2O5/c1-5-6-19-10-8-15(12(17)18)7-9(10)14-11(16)20-13(2,3)4/h5,9-10H,1,6-8H2,2-4H3,(H,14,16)(H,17,18)/t9-,10-/m0/s1 |
| InChIKey | UWXYAPYLJRLHID-UWVGGRQHSA-N |
| XLogP | 1.44 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|