C14H24N2O6 — CID 87497220
4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(oxiran-2-ylmethoxy)piperidine-1-carboxylic acid (PubChem CID 87497220) has the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(oxiran-2-ylmethoxy)piperidine-1-carboxylic acid.
| Compound Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(oxiran-2-ylmethoxy)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87497220 |
| Molecular Formula | C14H24N2O6 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(oxiran-2-ylmethoxy)piperidine-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)O)CC1OCC1CO1 |
| InChI | InChI=1S/C14H24N2O6/c1-14(2,3)22-12(17)15-10-4-5-16(13(18)19)6-11(10)21-8-9-7-20-9/h9-11H,4-8H2,1-3H3,(H,15,17)(H,18,19) |
| InChIKey | KCKNXLCFDDMCMJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|