C11H20N2O3 — CID 66707676
(3S,4R)-4-(ethylamino)-3-prop-2-enoxypiperidine-1-carboxylic acid (PubChem CID 66707676) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is (3S,4R)-4-(ethylamino)-3-prop-2-enoxypiperidine-1-carboxylic acid.
| Compound Name | (3S,4R)-4-(ethylamino)-3-prop-2-enoxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66707676 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (3S,4R)-4-(ethylamino)-3-prop-2-enoxypiperidine-1-carboxylic acid |
| SMILES | C=CCO[C@H]1CN(C(=O)O)CC[C@H]1NCC |
| InChI | InChI=1S/C11H20N2O3/c1-3-7-16-10-8-13(11(14)15)6-5-9(10)12-4-2/h3,9-10,12H,1,4-8H2,2H3,(H,14,15)/t9-,10+/m1/s1 |
| InChIKey | BJCAFJSKZAGOCY-ZJUUUORDSA-N |
| XLogP | 0.92 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|