C14H24N2O5 — CID 68515536
(3S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypiperidine-1-carboxylic acid (PubChem CID 68515536) has the molecular formula C14H24N2O5 and a molecular weight of 300.36 g/mol. Its IUPAC name is (3S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypiperidine-1-carboxylic acid.
| Compound Name | (3S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68515536 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (3S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypiperidine-1-carboxylic acid |
| SMILES | C=CCO[C@H]1CN(C(=O)O)CC[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N2O5/c1-5-8-20-11-9-16(13(18)19)7-6-10(11)15-12(17)21-14(2,3)4/h5,10-11H,1,6-9H2,2-4H3,(H,15,17)(H,18,19)/t10-,11+/m1/s1 |
| InChIKey | PWOLOWMCXDJALI-MNOVXSKESA-N |
| XLogP | 1.83 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|