C17H28N2O5 — CID 126502782
tert-butyl 3-(prop-2-enoxycarbonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 126502782) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is tert-butyl 3-(prop-2-enoxycarbonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 3-(prop-2-enoxycarbonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 126502782 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | tert-butyl 3-(prop-2-enoxycarbonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | C=CCOC(=O)NC1COC2(CCN(C(=O)OC(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C17H28N2O5/c1-5-10-22-14(20)18-13-11-17(23-12-13)6-8-19(9-7-17)15(21)24-16(2,3)4/h5,13H,1,6-12H2,2-4H3,(H,18,20) |
| InChIKey | HJKDIHWOTMKPEY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|