C14H22N2O5 — CID 126506835
(3R)-3-[methyl(prop-2-enoxycarbonyl)amino]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid (PubChem CID 126506835) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is (3R)-3-[methyl(prop-2-enoxycarbonyl)amino]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid.
| Compound Name | (3R)-3-[methyl(prop-2-enoxycarbonyl)amino]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 126506835 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (3R)-3-[methyl(prop-2-enoxycarbonyl)amino]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid |
| SMILES | C=CCOC(=O)N(C)[C@H]1COC2(CCN(C(=O)O)CC2)C1 |
| InChI | InChI=1S/C14H22N2O5/c1-3-8-20-13(19)15(2)11-9-14(21-10-11)4-6-16(7-5-14)12(17)18/h3,11H,1,4-10H2,2H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | JUFLNLABGCIGRQ-LLVKDONJSA-N |
| XLogP | 1.54 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|