C16H28N2O5 — CID 175253343
2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypiperidin-1-yl]ethyl formate (PubChem CID 175253343) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypiperidin-1-yl]ethyl formate.
| Compound Name | 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypiperidin-1-yl]ethyl formate |
|---|---|
| PubChem CID | 175253343 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypiperidin-1-yl]ethyl formate |
| SMILES | C=CCOC1CN(CCOC=O)CCC1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N2O5/c1-5-9-22-14-11-18(8-10-21-12-19)7-6-13(14)17-15(20)23-16(2,3)4/h5,12-14H,1,6-11H2,2-4H3,(H,17,20) |
| InChIKey | XXYPIUXLBDWMOH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|