C7H5ClN2O — CID 10855900
6-chloro-1,2-benzoxazol-3-amine (PubChem CID 10855900) has the molecular formula C7H5ClN2O and a molecular weight of 168.58 g/mol. Its IUPAC name is 6-chloro-1,2-benzoxazol-3-amine.
| Compound Name | 6-chloro-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 10855900 |
| Molecular Formula | C7H5ClN2O |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 6-chloro-1,2-benzoxazol-3-amine |
| SMILES | Nc1noc2cc(Cl)ccc12 |
| InChI | InChI=1S/C7H5ClN2O/c8-4-1-2-5-6(3-4)11-10-7(5)9/h1-3H,(H2,9,10) |
| InChIKey | VUMFEESWELAKKV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |