About 6-chloro-1,2-benzoxazol-3-amine
6-chloro-1,2-benzoxazol-3-amine (PubChem CID 10855900) has the molecular formula C7H5ClN2O
and a molecular weight of 168.58 g/mol. Its IUPAC name is 6-chloro-1,2-benzoxazol-3-amine.
Molecular Properties
| Compound Name | 6-chloro-1,2-benzoxazol-3-amine |
| PubChem CID | 10855900 |
| Molecular Formula | C7H5ClN2O |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 6-chloro-1,2-benzoxazol-3-amine |
| SMILES | Nc1noc2cc(Cl)ccc12 |
| InChI | InChI=1S/C7H5ClN2O/c8-4-1-2-5-6(3-4)11-10-7(5)9/h1-3H,(H2,9,10) |
| InChIKey | VUMFEESWELAKKV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-1,2-benzoxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1,2-benzoxazol-3-amine?
The IUPAC name of 6-chloro-1,2-benzoxazol-3-amine (CID 10855900) is 6-chloro-1,2-benzoxazol-3-amine.
What is the SMILES notation for 6-chloro-1,2-benzoxazol-3-amine?
The canonical SMILES for 6-chloro-1,2-benzoxazol-3-amine is Nc1noc2cc(Cl)ccc12.
What is the InChIKey of 6-chloro-1,2-benzoxazol-3-amine?
The InChIKey is VUMFEESWELAKKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O/c8-4-1-2-5-6(3-4)11-10-7(5)9/h1-3H,(H2,9,10).
What are the key properties of 6-chloro-1,2-benzoxazol-3-amine?
6-chloro-1,2-benzoxazol-3-amine has a molecular weight of 168.58 g/mol, XLogP of 2.06, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1,2-benzoxazol-3-amine is sourced from PubChem (CID 10855900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).