About 1,2-benzoxazol-3-amine
1,2-benzoxazol-3-amine (PubChem CID 2779749) has the molecular formula C7H6N2O
and a molecular weight of 134.14 g/mol. Its IUPAC name is 1,2-benzoxazol-3-amine.
Molecular Properties
| Compound Name | 1,2-benzoxazol-3-amine |
| PubChem CID | 2779749 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 1,2-benzoxazol-3-amine |
| SMILES | Nc1noc2ccccc12 |
| InChI | InChI=1S/C7H6N2O/c8-7-5-3-1-2-4-6(5)10-9-7/h1-4H,(H2,8,9) |
| InChIKey | NLMVYUBGWZWUGB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-benzoxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-benzoxazol-3-amine?
The IUPAC name of 1,2-benzoxazol-3-amine (CID 2779749) is 1,2-benzoxazol-3-amine.
What is the SMILES notation for 1,2-benzoxazol-3-amine?
The canonical SMILES for 1,2-benzoxazol-3-amine is Nc1noc2ccccc12.
What is the InChIKey of 1,2-benzoxazol-3-amine?
The InChIKey is NLMVYUBGWZWUGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O/c8-7-5-3-1-2-4-6(5)10-9-7/h1-4H,(H2,8,9).
What are the key properties of 1,2-benzoxazol-3-amine?
1,2-benzoxazol-3-amine has a molecular weight of 134.14 g/mol, XLogP of 1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-benzoxazol-3-amine is sourced from PubChem (CID 2779749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).