C22H31N3O4 — CID 108560646
butyl 4-[(1-benzyl-5-oxopyrrolidine-3-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 108560646) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is butyl 4-[(1-benzyl-5-oxopyrrolidine-3-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | butyl 4-[(1-benzyl-5-oxopyrrolidine-3-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108560646 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | butyl 4-[(1-benzyl-5-oxopyrrolidine-3-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(NC(=O)C2CC(=O)N(Cc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C22H31N3O4/c1-2-3-13-29-22(28)24-11-9-19(10-12-24)23-21(27)18-14-20(26)25(16-18)15-17-7-5-4-6-8-17/h4-8,18-19H,2-3,9-16H2,1H3,(H,23,27) |
| InChIKey | RYLQVDFGBAUGNG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|