C22H26N2O5S — CID 108563317
[3-[4-[(4-ethylphenyl)sulfonylamino]piperidine-1-carbonyl]phenyl] acetate (PubChem CID 108563317) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is [3-[4-[(4-ethylphenyl)sulfonylamino]piperidine-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-[(4-ethylphenyl)sulfonylamino]piperidine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108563317 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | [3-[4-[(4-ethylphenyl)sulfonylamino]piperidine-1-carbonyl]phenyl] acetate |
| SMILES | CCc1ccc(S(=O)(=O)NC2CCN(C(=O)c3cccc(OC(C)=O)c3)CC2)cc1 |
| InChI | InChI=1S/C22H26N2O5S/c1-3-17-7-9-21(10-8-17)30(27,28)23-19-11-13-24(14-12-19)22(26)18-5-4-6-20(15-18)29-16(2)25/h4-10,15,19,23H,3,11-14H2,1-2H3 |
| InChIKey | RXKSRZQLBSLGPO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|