C10H17NO3 — CID 10856475
tert-butyl 5-methyl-3,6-dihydrooxazine-2-carboxylate (PubChem CID 10856475) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is tert-butyl 5-methyl-3,6-dihydrooxazine-2-carboxylate.
| Compound Name | tert-butyl 5-methyl-3,6-dihydrooxazine-2-carboxylate |
|---|---|
| PubChem CID | 10856475 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | tert-butyl 5-methyl-3,6-dihydrooxazine-2-carboxylate |
| SMILES | CC1=CCN(C(=O)OC(C)(C)C)OC1 |
| InChI | InChI=1S/C10H17NO3/c1-8-5-6-11(13-7-8)9(12)14-10(2,3)4/h5H,6-7H2,1-4H3 |
| InChIKey | PUOFUBJKAJKKKF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|