C18H29N3O4 — CID 108564858
prop-2-enyl N-[1-(1-tert-butyl-5-oxopyrrolidine-3-carbonyl)piperidin-4-yl]carbamate (PubChem CID 108564858) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is prop-2-enyl N-[1-(1-tert-butyl-5-oxopyrrolidine-3-carbonyl)piperidin-4-yl]carbamate.
| Compound Name | prop-2-enyl N-[1-(1-tert-butyl-5-oxopyrrolidine-3-carbonyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108564858 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | prop-2-enyl N-[1-(1-tert-butyl-5-oxopyrrolidine-3-carbonyl)piperidin-4-yl]carbamate |
| SMILES | C=CCOC(=O)NC1CCN(C(=O)C2CC(=O)N(C(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C18H29N3O4/c1-5-10-25-17(24)19-14-6-8-20(9-7-14)16(23)13-11-15(22)21(12-13)18(2,3)4/h5,13-14H,1,6-12H2,2-4H3,(H,19,24) |
| InChIKey | ZIOLFPDGFWMTNT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|