C13H18O2 — CID 10856650
(Z)-3-methyl-5-phenylhex-2-ene-1,5-diol (PubChem CID 10856650) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (Z)-3-methyl-5-phenylhex-2-ene-1,5-diol.
| Compound Name | (Z)-3-methyl-5-phenylhex-2-ene-1,5-diol |
|---|---|
| PubChem CID | 10856650 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (Z)-3-methyl-5-phenylhex-2-ene-1,5-diol |
| SMILES | C/C(=C/CO)CC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C13H18O2/c1-11(8-9-14)10-13(2,15)12-6-4-3-5-7-12/h3-8,14-15H,9-10H2,1-2H3/b11-8- |
| InChIKey | XJTUOZDMWVUARQ-FLIBITNWSA-N |
| XLogP | 2.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|