C12H17NO2 — CID 10856676
(4R,5R)-4-methyl-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione (PubChem CID 10856676) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (4R,5R)-4-methyl-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione.
| Compound Name | (4R,5R)-4-methyl-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione |
|---|---|
| PubChem CID | 10856676 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (4R,5R)-4-methyl-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione |
| SMILES | C=CCN1C[C@H](C)[C@@]2(CCCC2=O)C1=O |
| InChI | InChI=1S/C12H17NO2/c1-3-7-13-8-9(2)12(11(13)15)6-4-5-10(12)14/h3,9H,1,4-8H2,2H3/t9-,12+/m0/s1 |
| InChIKey | UATSEHMJDMNRTD-JOYOIKCWSA-N |
| XLogP | 1.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|